cas: 1138-52-9 — see every product listed under this CAS number, including other names
3,5-DI-TERT-BUTYLPHENOL, 98%, 98% (CAS 1138-52-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1110PL-1g |
| cas | 1138-52-9 |
| size | 1g |
| availability | 1936.95g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 184.40 Pln | |
| Chemat | 50g | 270.80 Pln | |
| Chemat | 100g | 405.20 Pln | |
| Chemat | 250g | 611.60 Pln | |
| Chemat | 500g | 960.00 Pln | |
| Chemat | 1kg | 1562.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,5-ditert-butylphenol (CAS 1138-52-9) is a chemical compound with the molecular formula C14H22O and a molecular weight of 206.32 g/mol. IUPAC name: 3,5-ditert-butylphenol. InChIKey: ZDWSNKPLZUXBPE-UHFFFAOYSA-N.
| Molecular formula | C14H22O |
|---|---|
| Molecular weight | 206.32 g/mol |
| IUPAC name | 3,5-ditert-butylphenol |
| InChIKey | ZDWSNKPLZUXBPE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)O)C(C)(C)C |
Computed by PubChem (NCBI)