Products 1369937-64-3
CAS 1369937-64-3 is the registry number for 2-(tert-Butoxy)-1-isopropyl-4-methylbenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-2-[(2-methylpropan-2-yl)oxy]-1-propan-2-ylbenzene (CAS 1369937-64-3) is a chemical compound with the molecular formula C14H22O and a molecular weight of 206.32 g/mol. IUPAC name: 4-methyl-2-[(2-methylpropan-2-yl)oxy]-1-propan-2-ylbenzene. InChIKey: HFHSHFJHABRKEP-UHFFFAOYSA-N.
| Molecular formula | C14H22O |
|---|---|
| Molecular weight | 206.32 g/mol |
| IUPAC name | 4-methyl-2-[(2-methylpropan-2-yl)oxy]-1-propan-2-ylbenzene |
| InChIKey | HFHSHFJHABRKEP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(C)C)OC(C)(C)C |
Computed by PubChem (NCBI)