CAS 1138-52-9 appears in our catalog under these names: 3,5-Di-tert-butylphenol, 97%, 3,5-Di-tert-butylphenol, >95% (HPLC), 3,5-Di-tert-butylphenol, 3,5–Di–tert–butylphenol, 3,5-Di-tert-butylphenol/ 99.59% (existing batch purity). Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, TargetMol. Available pack sizes: 1g, 5g, 10g, 100mg, 500mg, 50mg, 10mg, 25g.
3,5-ditert-butylphenol (CAS 1138-52-9) is a chemical compound with the molecular formula C14H22O and a molecular weight of 206.32 g/mol. IUPAC name: 3,5-ditert-butylphenol. InChIKey: ZDWSNKPLZUXBPE-UHFFFAOYSA-N.
| Molecular formula | C14H22O |
|---|---|
| Molecular weight | 206.32 g/mol |
| IUPAC name | 3,5-ditert-butylphenol |
| InChIKey | ZDWSNKPLZUXBPE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)O)C(C)(C)C |
Computed by PubChem (NCBI)