cas: 1988-88-1 — see every product listed under this CAS number, including other names
3,5-Di(tert-butyl)-4-hydroxybenzonitrile, 97% (CAS 1988-88-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | BTB09888DA |
| cas | 1988-88-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 92.14 Pln | |
| Thermo Scientific | 10g | 671.99 Pln | |
| Thermo Scientific | 25g | 748.35 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
3,5-ditert-butyl-4-hydroxybenzonitrile (CAS 1988-88-1) is a chemical compound with the molecular formula C15H21NO and a molecular weight of 231.33 g/mol. IUPAC name: 3,5-ditert-butyl-4-hydroxybenzonitrile. InChIKey: AKXIIOLURNATOC-UHFFFAOYSA-N.
| Molecular formula | C15H21NO |
|---|---|
| Molecular weight | 231.33 g/mol |
| IUPAC name | 3,5-ditert-butyl-4-hydroxybenzonitrile |
| InChIKey | AKXIIOLURNATOC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)C#N |
Computed by PubChem (NCBI)