CAS 2096170-07-7 is the registry number for 1-(2,2,4,6-Tetramethyl-1,2,3,4-tetrahydroquinolin-7-yl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(2,2,4,6-tetramethyl-3,4-dihydro-1H-quinolin-7-yl)ethanone (CAS 2096170-07-7) is a chemical compound with the molecular formula C15H21NO and a molecular weight of 231.33 g/mol. IUPAC name: 1-(2,2,4,6-tetramethyl-3,4-dihydro-1H-quinolin-7-yl)ethanone. InChIKey: RLINDJFWJYDEJM-UHFFFAOYSA-N.
| Molecular formula | C15H21NO |
|---|---|
| Molecular weight | 231.33 g/mol |
| IUPAC name | 1-(2,2,4,6-tetramethyl-3,4-dihydro-1H-quinolin-7-yl)ethanone |
| InChIKey | RLINDJFWJYDEJM-UHFFFAOYSA-N |
| SMILES | CC1CC(NC2=C1C=C(C(=C2)C(=O)C)C)(C)C |
Computed by PubChem (NCBI)