CAS 115933-37-4 is the registry number for (2E)-1-(4-tert-Butylphenyl)-3-(dimethylamino)prop-2-en-1-one, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
(E)-1-(4-tert-butylphenyl)-3-(dimethylamino)prop-2-en-1-one (CAS 115933-37-4) is a chemical compound with the molecular formula C15H21NO and a molecular weight of 231.33 g/mol. IUPAC name: (E)-1-(4-tert-butylphenyl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: JGTIRSKOVUYUAT-ZHACJKMWSA-N.
| Molecular formula | C15H21NO |
|---|---|
| Molecular weight | 231.33 g/mol |
| IUPAC name | (E)-1-(4-tert-butylphenyl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | JGTIRSKOVUYUAT-ZHACJKMWSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)/C=C/N(C)C |
Computed by PubChem (NCBI)