cas: 1421-49-4 — see every product listed under this CAS number, including other names
3,5-Di-tert-butyl-4-hydroxybenzoic Acid, 98%, 98% (CAS 1421-49-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112HS0-25g |
| cas | 1421-49-4 |
| size | 25g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 117.20 Pln | |
| Chemat | 500g | 369.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,5-ditert-butyl-4-hydroxybenzoic acid (CAS 1421-49-4) is a chemical compound with the molecular formula C15H22O3 and a molecular weight of 250.33 g/mol. IUPAC name: 3,5-ditert-butyl-4-hydroxybenzoic acid. InChIKey: YEXOWHQZWLCHHD-UHFFFAOYSA-N.
| Molecular formula | C15H22O3 |
|---|---|
| Molecular weight | 250.33 g/mol |
| IUPAC name | 3,5-ditert-butyl-4-hydroxybenzoic acid |
| InChIKey | YEXOWHQZWLCHHD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)