cas: 3383-21-9 — see every product listed under this CAS number, including other names
3,5-Di-tert-butyl-o-benzoquinone 98% (CAS 3383-21-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A329099-1g |
| cas | 3383-21-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 854.31 Pln | |
| Ambeed | 100g | 2584.25 Pln | |
| Ambeed | 500g | 10127.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A329099 |
3,5-ditert-butylcyclohexa-3,5-diene-1,2-dione (CAS 3383-21-9) is a chemical compound with the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. IUPAC name: 3,5-ditert-butylcyclohexa-3,5-diene-1,2-dione. InChIKey: NOUZOVBGCDDMSX-UHFFFAOYSA-N.
| Molecular formula | C14H20O2 |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 3,5-ditert-butylcyclohexa-3,5-diene-1,2-dione |
| InChIKey | NOUZOVBGCDDMSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=O)C(=O)C(=C1)C(C)(C)C |
Computed by PubChem (NCBI)