CAS 54530-94-8 is the registry number for 3,5-Diaminobenzenesulfonic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
3,5-diaminobenzenesulfonic acid (CAS 54530-94-8) is a chemical compound with the molecular formula C6H8N2O3S and a molecular weight of 188.21 g/mol. IUPAC name: 3,5-diaminobenzenesulfonic acid. InChIKey: NSWDWUHBMOIGOA-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O3S |
|---|---|
| Molecular weight | 188.21 g/mol |
| IUPAC name | 3,5-diaminobenzenesulfonic acid |
| InChIKey | NSWDWUHBMOIGOA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N)S(=O)(=O)O)N |
Computed by PubChem (NCBI)