cas: 16727-44-9 — see every product listed under this CAS number, including other names
3,5-Dibromo-2,6-dimethoxypyridine, 98% (CAS 16727-44-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F462405-1G |
| cas | 16727-44-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 570.65 Pln | |
| Fluorochem | 25g | 857.01 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,5-dibromo-2,6-dimethoxypyridine (CAS 16727-44-9) is a chemical compound with the molecular formula C7H7Br2NO2 and a molecular weight of 296.94 g/mol. IUPAC name: 3,5-dibromo-2,6-dimethoxypyridine. InChIKey: SQWUBNSHUMRETN-UHFFFAOYSA-N.
| Molecular formula | C7H7Br2NO2 |
|---|---|
| Molecular weight | 296.94 g/mol |
| IUPAC name | 3,5-dibromo-2,6-dimethoxypyridine |
| InChIKey | SQWUBNSHUMRETN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=N1)OC)Br)Br |
Computed by PubChem (NCBI)