CAS 1263378-22-8 appears in our catalog under these names: Methyl 4-bromonicotinate hydrobromide, ≥98.4%, ≥98.4%, 4-Bromo-nicotinic acid methyl ester hydrobromide. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g.
Methyl 4-bromopyridine-3-carboxylate;hydrobromide (CAS 1263378-22-8) is a chemical compound with the molecular formula C7H7Br2NO2 and a molecular weight of 296.94 g/mol. IUPAC name: methyl 4-bromopyridine-3-carboxylate;hydrobromide. InChIKey: VCJVHCAMIHYKKA-UHFFFAOYSA-N.
| Molecular formula | C7H7Br2NO2 |
|---|---|
| Molecular weight | 296.94 g/mol |
| IUPAC name | methyl 4-bromopyridine-3-carboxylate;hydrobromide |
| InChIKey | VCJVHCAMIHYKKA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CN=C1)Br.Br |
Computed by PubChem (NCBI)