CAS 16727-44-9 appears in our catalog under these names: 3,5-dibromo-2,6-dimethoxypyridine, 95%, 3,5-Dibromo-2,6-dimethoxypyridine 98%, 3,5-Dibromo-2,6-dimethoxypyridine, 98%, 98%, 3,5-Dibromo-2,6-dimethoxypyridine, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 10g, 250mg, 100g.
3,5-dibromo-2,6-dimethoxypyridine (CAS 16727-44-9) is a chemical compound with the molecular formula C7H7Br2NO2 and a molecular weight of 296.94 g/mol. IUPAC name: 3,5-dibromo-2,6-dimethoxypyridine. InChIKey: SQWUBNSHUMRETN-UHFFFAOYSA-N.
| Molecular formula | C7H7Br2NO2 |
|---|---|
| Molecular weight | 296.94 g/mol |
| IUPAC name | 3,5-dibromo-2,6-dimethoxypyridine |
| InChIKey | SQWUBNSHUMRETN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=N1)OC)Br)Br |
Computed by PubChem (NCBI)