3,5-Dichloropyrazolo[1,5-a]pyrimidine, 95%
cas: 1823383-15-8 — see every product listed under this CAS number, including other names
3,5-Dichloropyrazolo[1,5-a]pyrimidine, 95% (CAS 1823383-15-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A684893-100mg |
| cas | 1823383-15-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 537.25 Pln | |
| Ambeed | 1g | 1277.06 Pln | |
| Ambeed | 5g | 4330.88 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 569.82 Pln | |
| BLDpharm | 1g | 1369.54 Pln | |
| BLDpharm | 5g | 4662.83 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 530.00 Pln | |
| Fluorochem | 100mg | 612.30 Pln | |
| Fluorochem | 250mg | 966.34 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3,5-dichloropyrazolo[1,5-a]pyrimidine (CAS 1823383-15-8) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 3,5-dichloropyrazolo[1,5-a]pyrimidine. InChIKey: QNVJBGWKEBOJDY-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 3,5-dichloropyrazolo[1,5-a]pyrimidine |
| InChIKey | QNVJBGWKEBOJDY-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C=N2)Cl)N=C1Cl |
Computed by PubChem (NCBI)
Synonyms:
3,5-Dichloropyrazolo[1,5-a]pyrimidine