cas: 870717-92-3 — see every product listed under this CAS number, including other names
3,5-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 95% (CAS 870717-92-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F338091-250MG |
| cas | 870717-92-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 279.09 Pln | |
| Fluorochem | 5g | 857.01 Pln | |
| Fluorochem | 25g | 2481.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 870717-92-3) is a chemical compound with the molecular formula C13H15BF2O3 and a molecular weight of 268.07 g/mol. IUPAC name: 3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: KWYZDHWDFMOVOR-UHFFFAOYSA-N.
| Molecular formula | C13H15BF2O3 |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | 3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | KWYZDHWDFMOVOR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2F)C=O)F |
Computed by PubChem (NCBI)