CAS 2088247-40-7 appears in our catalog under these names: 3,5-Difluoro-4-formylphenylboronic acid, pinacol ester, 98%, 2,6-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g.
2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 2088247-40-7) is a chemical compound with the molecular formula C13H15BF2O3 and a molecular weight of 268.07 g/mol. IUPAC name: 2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: ZYFPVORSGDORBP-UHFFFAOYSA-N.
| Molecular formula | C13H15BF2O3 |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | 2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | ZYFPVORSGDORBP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)C=O)F |
Computed by PubChem (NCBI)