CAS 2121512-61-4 appears in our catalog under these names: 2,6-Difluoro-3-formylphenylboronic acid pinacol ester, 95%, 2,4-Difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 98%, 2,6-Difluoro-3-formylphenylboronic acid pinacol ester, 98%, 98%, 2,6-Difluoro-3-formylphenylboronic acid pinacol ester. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 100mg.
2,4-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 2121512-61-4) is a chemical compound with the molecular formula C13H15BF2O3 and a molecular weight of 268.07 g/mol. IUPAC name: 2,4-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: FJXPIHMLJAUNHF-UHFFFAOYSA-N.
| Molecular formula | C13H15BF2O3 |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | 2,4-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | FJXPIHMLJAUNHF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2F)C=O)F |
Computed by PubChem (NCBI)