cas: 1417569-98-2 — see every product listed under this CAS number, including other names
3,5-Difluoro-4-(trifluoromethyl)benzaldehyde 97% (CAS 1417569-98-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A815947-100mg |
| cas | 1417569-98-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1115.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A815947 |
3,5-difluoro-4-(trifluoromethyl)benzaldehyde (CAS 1417569-98-2) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 3,5-difluoro-4-(trifluoromethyl)benzaldehyde. InChIKey: QTIOVUAQKHXLJC-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 3,5-difluoro-4-(trifluoromethyl)benzaldehyde |
| InChIKey | QTIOVUAQKHXLJC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(F)(F)F)F)C=O |
Computed by PubChem (NCBI)