Products 134099-34-6
CAS 134099-34-6 appears in our catalog under these names: 2,6-Difluoro-4-(trifluoromethyl)benzaldehyde, 95%, 2,6-Difluoro-4-(trifluoromethyl)benzaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 2g, 10g.
2,6-difluoro-4-(trifluoromethyl)benzaldehyde (CAS 134099-34-6) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 2,6-difluoro-4-(trifluoromethyl)benzaldehyde. InChIKey: SEBPODPGYAOCAN-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 2,6-difluoro-4-(trifluoromethyl)benzaldehyde |
| InChIKey | SEBPODPGYAOCAN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C=O)F)C(F)(F)F |
Computed by PubChem (NCBI)