CAS 1092712-26-9 appears in our catalog under these names: 1-(2,6-Difluorophenyl)-2,2,2-trifluoroethanone, 95%, 1-(2,6-Difluoro-phenyl)-2,2,2-trifluoro-ethanone, 95%, 1-(2,6-Difluoro-phenyl)-2,2,2-trifluoro-ethanone, 1-(2,6-Difluoro-phenyl)-2,2,2-trifluoro-ethanone, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 10g, 2,5g.
1-(2,6-difluorophenyl)-2,2,2-trifluoroethanone (CAS 1092712-26-9) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 1-(2,6-difluorophenyl)-2,2,2-trifluoroethanone. InChIKey: FGBCJKYISOMHFD-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 1-(2,6-difluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | FGBCJKYISOMHFD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)