CAS 144797-68-2 appears in our catalog under these names: 3,5–difluorobenzamidine hydrochloride, 3,5-Difluorobenzamidine Hydrochloride, 95%, 95%, 3,5-Difluorobenzamidine hydrochloride, 95%, 3,5-Difluorobenzamidine hydrochloride, 97%. Offered by: GLPBio, Chemat, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg, 25g.
3,5-difluorobenzenecarboximidamide;hydrochloride (CAS 144797-68-2) is a chemical compound with the molecular formula C7H7ClF2N2 and a molecular weight of 192.59 g/mol. IUPAC name: 3,5-difluorobenzenecarboximidamide;hydrochloride. InChIKey: QCCACCYICHJVIN-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF2N2 |
|---|---|
| Molecular weight | 192.59 g/mol |
| IUPAC name | 3,5-difluorobenzenecarboximidamide;hydrochloride |
| InChIKey | QCCACCYICHJVIN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(=N)N.Cl |
Computed by PubChem (NCBI)