3,5-Diisopropyl-[1,1'-biphenyl]-4-amine, 98%
cas: 389104-62-5 — see every product listed under this CAS number, including other names
3,5-Diisopropyl-[1,1'-biphenyl]-4-amine, 98% (CAS 389104-62-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g, 50g, 250g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1908799-1g |
| cas | 389104-62-5 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 581.75 Pln | |
| Ambeed | 25g | 1811.06 Pln | |
| Ambeed | 100g | 5810.50 Pln | |
| BLDpharm | 1g | 231.05 Pln | |
| BLDpharm | 5g | 625.36 Pln | |
| BLDpharm | 25g | 1947.12 Pln | |
| BLDpharm | 100g | 6262.26 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 515.60 Pln | |
| Chemat | 25g | 957.20 Pln | |
| Chemat | 50g | 1648.40 Pln | |
| Chemat | 100g | 2819.60 Pln | |
| Chemat | 250g | 5574.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-phenyl-2,6-di(propan-2-yl)aniline (CAS 389104-62-5) is a chemical compound with the molecular formula C18H23N and a molecular weight of 253.4 g/mol. IUPAC name: 4-phenyl-2,6-di(propan-2-yl)aniline. InChIKey: SJXGUJDBIYKQTJ-UHFFFAOYSA-N.
| Molecular formula | C18H23N |
|---|---|
| Molecular weight | 253.4 g/mol |
| IUPAC name | 4-phenyl-2,6-di(propan-2-yl)aniline |
| InChIKey | SJXGUJDBIYKQTJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1N)C(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
3,5-Diisopropyl-4-aminobiphenyl, Biphenyl, 3,5-diisopropyl-4-amino-, (1,1'-Biphenyl)-4-amine, 3,5-bis(1-methylethyl)-, [1,1'-Biphenyl]-4-amine, 3,5-bis(1-methylethyl)-, 3,5-diisopropyl-[1,1'-biphenyl]-4-amine, 3,5-diisopropylbiphenyl-4-amine, 3,5-Diisopropyl-4-biphenylamine, SJXGUJDBIYKQTJ-UHFFFAOYSA-N, 4-Phenyl-2,6-di(prop-2-yl)aniline, 3,5-Di(propan-2-yl)[1,1'-biphenyl]-4-amine