CAS 199392-14-8 is the registry number for 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydroanthracen-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-amine (CAS 199392-14-8) is a chemical compound with the molecular formula C18H23N and a molecular weight of 253.4 g/mol. IUPAC name: 5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-amine. InChIKey: IZHQZCHJRKQYMZ-UHFFFAOYSA-N.
| Molecular formula | C18H23N |
|---|---|
| Molecular weight | 253.4 g/mol |
| IUPAC name | 5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-amine |
| InChIKey | IZHQZCHJRKQYMZ-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=C3C=CC(=CC3=C2)N)(C)C)C |
Computed by PubChem (NCBI)