CAS 6050-18-6 is the registry number for Dimesitylamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)aniline (CAS 6050-18-6) is a chemical compound with the molecular formula C18H23N and a molecular weight of 253.4 g/mol. IUPAC name: 2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)aniline. InChIKey: HSXWOKPAUZMPML-UHFFFAOYSA-N.
| Molecular formula | C18H23N |
|---|---|
| Molecular weight | 253.4 g/mol |
| IUPAC name | 2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)aniline |
| InChIKey | HSXWOKPAUZMPML-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC2=C(C=C(C=C2C)C)C)C |
Computed by PubChem (NCBI)