cas: 479200-82-3 — see every product listed under this CAS number, including other names
3,6,9,12,15,18,21,24,27,30,33-Undecaoxapentatriacontane-1,35-diamine, 95% (CAS 479200-82-3) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 50mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F870310-5MG |
| cas | 479200-82-3 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5mg | 289.50 Pln | |
| Fluorochem | 10mg | 414.46 Pln | |
| Fluorochem | 50mg | 950.72 Pln | |
| Fluorochem | 100mg | 1424.52 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (CAS 479200-82-3) is a chemical compound with the molecular formula C24H52N2O11 and a molecular weight of 544.7 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: TZQCFDTWLKAGLL-UHFFFAOYSA-N.
| Molecular formula | C24H52N2O11 |
|---|---|
| Molecular weight | 544.7 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | TZQCFDTWLKAGLL-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN)N |
Computed by PubChem (NCBI)