cas: 479200-82-3 — see every product listed under this CAS number, including other names
Amino-PEG11-amine 97% (CAS 479200-82-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A883472-100mg |
| cas | 479200-82-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1460.62 Pln | |
| Ambeed | 5g | 5677.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A883472 |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (CAS 479200-82-3) is a chemical compound with the molecular formula C24H52N2O11 and a molecular weight of 544.7 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: TZQCFDTWLKAGLL-UHFFFAOYSA-N.
| Molecular formula | C24H52N2O11 |
|---|---|
| Molecular weight | 544.7 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | TZQCFDTWLKAGLL-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN)N |
Computed by PubChem (NCBI)