cas: 297162-47-1 — see every product listed under this CAS number, including other names
3,6,9,12,15,18-Hexaoxaeicosanoic acid, 20-hydroxy-, 1,1-dimethylethylester, 95% (CAS 297162-47-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F863868-250MG |
| cas | 297162-47-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 2205.49 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate (CAS 297162-47-1) is a chemical compound with the molecular formula C18H36O9 and a molecular weight of 396.5 g/mol. IUPAC name: tert-butyl 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate. InChIKey: BHPCFQUBUVPQGG-UHFFFAOYSA-N.
| Molecular formula | C18H36O9 |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate |
| InChIKey | BHPCFQUBUVPQGG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)