CAS 297162-47-1 appears in our catalog under these names: Hydroxy-Peg6-CH2CO2tBu, 96%, Hydroxy–PEG6–CH2–Boc, Hydroxy-PEG6-CH2-Boc 98%, tert-Butyl 20-hydroxy-3,6,9,12,15,18-hexaoxaicosanoate, 98%, 98%, 3,6,9,12,15,18-Hexaoxaeicosanoic acid, 20-hydroxy-, 1,1-dimethylethylester, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g, 25g, 250 mg, 1 g.
Tert-butyl 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate (CAS 297162-47-1) is a chemical compound with the molecular formula C18H36O9 and a molecular weight of 396.5 g/mol. IUPAC name: tert-butyl 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate. InChIKey: BHPCFQUBUVPQGG-UHFFFAOYSA-N.
| Molecular formula | C18H36O9 |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate |
| InChIKey | BHPCFQUBUVPQGG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)