cas: 297162-47-1 — see every product listed under this CAS number, including other names
tert-Butyl 20-hydroxy-3,6,9,12,15,18-hexaoxaicosanoate, 98%, 98% (CAS 297162-47-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I6I7-100mg |
| cas | 297162-47-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1302.80 Pln | |
| Chemat | 10g | 2267.60 Pln | |
| Chemat | 25g | 4749.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate (CAS 297162-47-1) is a chemical compound with the molecular formula C18H36O9 and a molecular weight of 396.5 g/mol. IUPAC name: tert-butyl 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate. InChIKey: BHPCFQUBUVPQGG-UHFFFAOYSA-N.
| Molecular formula | C18H36O9 |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate |
| InChIKey | BHPCFQUBUVPQGG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)