cas: 919197-88-9 — see every product listed under this CAS number, including other names
3,6-Dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine 97% (CAS 919197-88-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A897524-100mg |
| cas | 919197-88-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 275.81 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 804.25 Pln | |
| Ambeed | 5g | 2289.44 Pln | |
| Ambeed | 25g | 10149.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A897524 |
3,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine (CAS 919197-88-9) is a chemical compound with the molecular formula C10H13BCl2N2O2 and a molecular weight of 274.94 g/mol. IUPAC name: 3,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine. InChIKey: FOWSTROWTZRKFD-UHFFFAOYSA-N.
| Molecular formula | C10H13BCl2N2O2 |
|---|---|
| Molecular weight | 274.94 g/mol |
| IUPAC name | 3,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine |
| InChIKey | FOWSTROWTZRKFD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)