cas: 919197-88-9 — see every product listed under this CAS number, including other names
3,6-Dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine, 97%, 97% (CAS 919197-88-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GUWP-100mg |
| cas | 919197-88-9 |
| size | 100mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 525.20 Pln | |
| Chemat | 5g | 1686.80 Pln | |
| Chemat | 25g | 5747.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine (CAS 919197-88-9) is a chemical compound with the molecular formula C10H13BCl2N2O2 and a molecular weight of 274.94 g/mol. IUPAC name: 3,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine. InChIKey: FOWSTROWTZRKFD-UHFFFAOYSA-N.
| Molecular formula | C10H13BCl2N2O2 |
|---|---|
| Molecular weight | 274.94 g/mol |
| IUPAC name | 3,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine |
| InChIKey | FOWSTROWTZRKFD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)