Products 785777-98-2
CAS 785777-98-2 appears in our catalog under these names: 2,5-Dichloro-4-(trifluoromethyl)pyrimidine, 98%, 2,5-Dichloro-4-(trifluoromethyl)pyrimidine, 95%. Offered by: Fluorochem, Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,5-dichloro-4-(trifluoromethyl)pyrimidine (CAS 785777-98-2) is a chemical compound with the molecular formula C5HCl2F3N2 and a molecular weight of 216.97 g/mol. IUPAC name: 2,5-dichloro-4-(trifluoromethyl)pyrimidine. InChIKey: TXXQDEGSBJJCSM-UHFFFAOYSA-N.
| Molecular formula | C5HCl2F3N2 |
|---|---|
| Molecular weight | 216.97 g/mol |
| IUPAC name | 2,5-dichloro-4-(trifluoromethyl)pyrimidine |
| InChIKey | TXXQDEGSBJJCSM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)