Products 1393562-47-4
CAS 1393562-47-4 is the registry number for 2,5-Dichloro-3-(trifluoromethyl)pyrazine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2,5-dichloro-3-(trifluoromethyl)pyrazine (CAS 1393562-47-4) is a chemical compound with the molecular formula C5HCl2F3N2 and a molecular weight of 216.97 g/mol. IUPAC name: 2,5-dichloro-3-(trifluoromethyl)pyrazine. InChIKey: OGOVNIPATHKPRH-UHFFFAOYSA-N.
| Molecular formula | C5HCl2F3N2 |
|---|---|
| Molecular weight | 216.97 g/mol |
| IUPAC name | 2,5-dichloro-3-(trifluoromethyl)pyrazine |
| InChIKey | OGOVNIPATHKPRH-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)