3,8-Dibromo-1,10-phenanthroline, 97%
cas: 100125-12-0 — see every product listed under this CAS number, including other names
3,8-Dibromo-1,10-phenanthroline, 97% (CAS 100125-12-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A174915-250mg |
| cas | 100125-12-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 620.69 Pln | |
| Ambeed | 10g | 1060.12 Pln | |
| Ambeed | 25g | 2295.00 Pln | |
| Ambeed | 100g | 7618.31 Pln | |
| BLDpharm | 250mg | 131.09 Pln | |
| BLDpharm | 1g | 203.29 Pln | |
| BLDpharm | 5g | 664.24 Pln | |
| BLDpharm | 10g | 1136.29 Pln | |
| BLDpharm | 25g | 2469.16 Pln | |
| BLDpharm | 100g | 8206.02 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3,8-dibromo-1,10-phenanthroline (CAS 100125-12-0) is a chemical compound with the molecular formula C12H6Br2N2 and a molecular weight of 338.00 g/mol. IUPAC name: 3,8-dibromo-1,10-phenanthroline. InChIKey: IDWJREBUVYSPKS-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2N2 |
|---|---|
| Molecular weight | 338.00 g/mol |
| IUPAC name | 3,8-dibromo-1,10-phenanthroline |
| InChIKey | IDWJREBUVYSPKS-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C3=NC=C(C=C31)Br)Br |
Computed by PubChem (NCBI)