3,8-Dibromo-1,10-phenanthroline, 95%
cas: 100125-12-0 — see every product listed under this CAS number, including other names
3,8-Dibromo-1,10-phenanthroline, 95% (CAS 100125-12-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11121O-250mg |
| cas | 100125-12-0 |
| size | 250mg |
| availability | 250g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 424.40 Pln | |
| Chemat | 10g | 765.20 Pln | |
| Chemat | 25g | 1754.00 Pln | |
| Chemat | 50g | 2267.60 Pln | |
| Chemat | 100g | 3597.20 Pln | |
| Chemat | 250g | 8176.40 Pln | |
| Fluorochem | 250mg | 117.68 Pln | |
| Fluorochem | 1g | 180.16 Pln | |
| Fluorochem | 5g | 555.03 Pln | |
| Fluorochem | 10g | 955.93 Pln | |
| Fluorochem | 25g | 2273.18 Pln | |
| Fluorochem | 100g | 7443.23 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,8-dibromo-1,10-phenanthroline (CAS 100125-12-0) is a chemical compound with the molecular formula C12H6Br2N2 and a molecular weight of 338.00 g/mol. IUPAC name: 3,8-dibromo-1,10-phenanthroline. InChIKey: IDWJREBUVYSPKS-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2N2 |
|---|---|
| Molecular weight | 338.00 g/mol |
| IUPAC name | 3,8-dibromo-1,10-phenanthroline |
| InChIKey | IDWJREBUVYSPKS-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C3=NC=C(C=C31)Br)Br |
Computed by PubChem (NCBI)