cas: 72830-07-0 — see every product listed under this CAS number, including other names
3,4-Dimethoxy-2-methylpyridine 1-oxide, 98%, 98% (CAS 72830-07-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FAA7-100mg |
| cas | 72830-07-0 |
| size | 100mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 491.60 Pln | |
| Chemat | 5g | 1355.60 Pln | |
| Chemat | 10g | 2589.20 Pln | |
| Chemat | 25g | 4787.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,4-dimethoxy-2-methyl-1-oxidopyridin-1-ium (CAS 72830-07-0) is a chemical compound with the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. IUPAC name: 3,4-dimethoxy-2-methyl-1-oxidopyridin-1-ium. InChIKey: UMVFRRJTPKYVAY-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 3,4-dimethoxy-2-methyl-1-oxidopyridin-1-ium |
| InChIKey | UMVFRRJTPKYVAY-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C=CC(=C1OC)OC)[O-] |
Computed by PubChem (NCBI)