CAS 1187173-72-3 appears in our catalog under these names: 2-Isopropyl-5-methyloxazole-4-carboxylic acid, 95%, 2-Isopropyl-5-methyloxazole-4-carboxylic acid, 98+%, 5-Methyl-2-(propan-2-yl)-1,3-oxazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 0,5g, 50mg.
5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxylic acid (CAS 1187173-72-3) is a chemical compound with the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. IUPAC name: 5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxylic acid. InChIKey: JBJZTLXRNSABDA-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxylic acid |
| InChIKey | JBJZTLXRNSABDA-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C(C)C)C(=O)O |
Computed by PubChem (NCBI)