CAS 876717-62-3 appears in our catalog under these names: 3-Isopropyl-5-methylisoxazole-4-carboxylic acid, 95%, 3-Isopropyl-5-methylisoxazole-4-carboxylic acid 98+%, 3-Isopropyl-5-methylisoxazole-4-carboxylic acid, 98+%, 98+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid (CAS 876717-62-3) is a chemical compound with the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. IUPAC name: 5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid. InChIKey: TYGXTLZIBFXYQP-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid |
| InChIKey | TYGXTLZIBFXYQP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C(C)C)C(=O)O |
Computed by PubChem (NCBI)