3-(((Ethylimino)methylene)amino)-N,N,N-trimethylpropan-1-aminium iodide 98%
cas: 22572-40-3 — see every product listed under this CAS number, including other names
3-(((Ethylimino)methylene)amino)-N,N,N-trimethylpropan-1-aminium iodide 98% (CAS 22572-40-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A199878-1g |
| cas | 22572-40-3 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 381.50 Pln | |
| Ambeed | 100g | 1299.31 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A199878 |
3-(ethyliminomethylideneamino)propyl-trimethylazanium iodide (CAS 22572-40-3) is a chemical compound with the molecular formula C9H20IN3 and a molecular weight of 297.18 g/mol. IUPAC name: 3-(ethyliminomethylideneamino)propyl-trimethylazanium iodide. InChIKey: AGSKWMRPXWHSPF-UHFFFAOYSA-M.
| Molecular formula | C9H20IN3 |
|---|---|
| Molecular weight | 297.18 g/mol |
| IUPAC name | 3-(ethyliminomethylideneamino)propyl-trimethylazanium iodide |
| InChIKey | AGSKWMRPXWHSPF-UHFFFAOYSA-M |
| SMILES | CCN=C=NCCC[N+](C)(C)C.[I-] |
Computed by PubChem (NCBI)
Synonyms:
EDC methiodide, 1-ethyl-3-(3-(dimethylamino)propyl)carbodiimide methiodide, 1-[3-(Dimethylamino)propyl]-3-ethylcarbodiimide methiodide, 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide methiodide, 1-Propanaminium, 3-(ethylcarbonimidoylamino)-N,N,N-trimethyl-, iodide, 1-(3-(dimethylamino)propyl)-3-ethylcarbodiimide methiodide, ETC carbodiimide, (3-((Ethylimidocarbonyl)amino)propyl)trimethylammonium iodide, 3-(((Ethylimino)methylene)amino)-N,N,N-trimethylpropan-1-aminium iodide, 3-[[(Ethylimino)methylene]amino]-N,N,N-trimethylpropan-1-aminium Iodide