cas: 453581-60-7 — see every product listed under this CAS number, including other names
3-((2,3,5,6-Tetramethylphenyl)Sulfonamido)Propanoic Acid, 96%, 96% (CAS 453581-60-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DIR5-100mg |
| cas | 453581-60-7 |
| size | 100mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]propanoic acid (CAS 453581-60-7) is a chemical compound with the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. IUPAC name: 3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]propanoic acid. InChIKey: LJXLBOZCWFCYKY-UHFFFAOYSA-N.
| Molecular formula | C13H19NO4S |
|---|---|
| Molecular weight | 285.36 g/mol |
| IUPAC name | 3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]propanoic acid |
| InChIKey | LJXLBOZCWFCYKY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)NCCC(=O)O)C)C |
Computed by PubChem (NCBI)