CAS 453581-60-7 appears in our catalog under these names: 3-([(2,3,5,6-Tetramethylphenyl)sulfonyl]amino)propanoic acid, 95%, 3-((2,3,5,6-Tetramethylphenyl)Sulfonamido)Propanoic Acid, 96%, 96%, 3-((2,3,5,6-tetramethylphenyl)sulfonamido)propanoic acid, 96%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 5g, 1g, 100mg.
3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]propanoic acid (CAS 453581-60-7) is a chemical compound with the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. IUPAC name: 3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]propanoic acid. InChIKey: LJXLBOZCWFCYKY-UHFFFAOYSA-N.
| Molecular formula | C13H19NO4S |
|---|---|
| Molecular weight | 285.36 g/mol |
| IUPAC name | 3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]propanoic acid |
| InChIKey | LJXLBOZCWFCYKY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)NCCC(=O)O)C)C |
Computed by PubChem (NCBI)