CAS 269726-89-8 appears in our catalog under these names: Boc-(R)-3-amino-4-(2-thienyl)-butyric acid, 95%, Boc-(R)-3-Amino-4-(2-thienyl)-butyric acid, 97%, 97%, (R)-3-((tert-Butoxycarbonyl)amino)-4-(thiophen-2-yl)butanoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-thiophen-2-ylbutanoic acid (CAS 269726-89-8) is a chemical compound with the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-thiophen-2-ylbutanoic acid. InChIKey: USQYZXFFROGLRS-VIFPVBQESA-N.
| Molecular formula | C13H19NO4S |
|---|---|
| Molecular weight | 285.36 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-thiophen-2-ylbutanoic acid |
| InChIKey | USQYZXFFROGLRS-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CS1)CC(=O)O |
Computed by PubChem (NCBI)