cas: 2172852-92-3 — see every product listed under this CAS number, including other names
3-((2-(2-Chlorophenyl)-2-hydroxyethyl)amino)-3-methylbutanoic acid, 95%, 95% (CAS 2172852-92-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FSNE-100mg |
| cas | 2172852-92-3 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 496.40 Pln | |
| Chemat | 1g | 1710.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-3-methylbutanoic acid (CAS 2172852-92-3) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: 3-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-3-methylbutanoic acid. InChIKey: GBUCKHPOVONJOV-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 3-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-3-methylbutanoic acid |
| InChIKey | GBUCKHPOVONJOV-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)O)NCC(C1=CC=CC=C1Cl)O |
Computed by PubChem (NCBI)