CAS 367517-26-8 appears in our catalog under these names: H-D-Tyr(all)-ome hydrochloride, 98%, (R)-Methyl 3-(4-(allyloxy)phenyl)-2-aminopropanoate hydrochloride, 97%, H-D-Tyr(All)-OMe*HCl. Offered by: Combi-blocks, AmBeed, Iris Biotech. Available pack sizes: 1g, 5g, 250mg.
Methyl (2R)-2-amino-3-(4-prop-2-enoxyphenyl)propanoate;hydrochloride (CAS 367517-26-8) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: methyl (2R)-2-amino-3-(4-prop-2-enoxyphenyl)propanoate;hydrochloride. InChIKey: RNTKDRSTELCRPC-UTONKHPSSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(4-prop-2-enoxyphenyl)propanoate;hydrochloride |
| InChIKey | RNTKDRSTELCRPC-UTONKHPSSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=C(C=C1)OCC=C)N.Cl |
Computed by PubChem (NCBI)