cas: 94-21-3 — see every product listed under this CAS number, including other names
3-((4-Formylphenyl)(methyl)amino)propanenitrile (CAS 94-21-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239478-1G |
| cas | 94-21-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 325.94 Pln | |
| Fluorochem | 25g | 1096.51 Pln | |
| Fluorochem | 100g | 3288.44 Pln |
| delivery time | 3-4 weeks |
|---|
3-(4-formyl-N-methylanilino)propanenitrile (CAS 94-21-3) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 3-(4-formyl-N-methylanilino)propanenitrile. InChIKey: DNRTTXXWWAKULZ-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 3-(4-formyl-N-methylanilino)propanenitrile |
| InChIKey | DNRTTXXWWAKULZ-UHFFFAOYSA-N |
| SMILES | CN(CCC#N)C1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)