cas: 1171044-16-8 — see every product listed under this CAS number, including other names
3-((4-Methylpiperazin-1-yl)methyl)phenylboronic acid, 95% (CAS 1171044-16-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627926-1G |
| cas | 1171044-16-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 768.50 Pln | |
| Fluorochem | 100mg | 253.05 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 500mg | 502.97 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[3-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid (CAS 1171044-16-8) is a chemical compound with the molecular formula C12H19BN2O2 and a molecular weight of 234.10 g/mol. IUPAC name: [3-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid. InChIKey: NGSHSQFNJGUKCF-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O2 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | [3-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid |
| InChIKey | NGSHSQFNJGUKCF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CN2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)