Products 1017234-23-9
CAS 1017234-23-9 is the registry number for 3-((S)-1-(Methyl((S)-1-phenylethyl)amino)ethyl)phenol, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-[(1S)-1-[methyl-[(1S)-1-phenylethyl]amino]ethyl]phenol (CAS 1017234-23-9) is a chemical compound with the molecular formula C17H21NO and a molecular weight of 255.35 g/mol. IUPAC name: 3-[(1S)-1-[methyl-[(1S)-1-phenylethyl]amino]ethyl]phenol. InChIKey: RBTONRBPOFOGTK-KBPBESRZSA-N.
| Molecular formula | C17H21NO |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | 3-[(1S)-1-[methyl-[(1S)-1-phenylethyl]amino]ethyl]phenol |
| InChIKey | RBTONRBPOFOGTK-KBPBESRZSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N(C)[C@@H](C)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)