cas: 436867-71-9 — see every product listed under this CAS number, including other names
3-((TERT-BUTOXYCARBONYL)AMINO)PIPERIDINE-3-CARBOXYLIC ACID, 95% (CAS 436867-71-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F538406-50MG |
| cas | 436867-71-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 419.66 Pln | |
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 872.63 Pln | |
| Fluorochem | 500mg | 1513.03 Pln | |
| Fluorochem | 1g | 2075.33 Pln | |
| Fluorochem | 2.5g | 5110.72 Pln | |
| Fluorochem | 5g | 8588.66 Pln | |
| Fluorochem | 10g | 16434.86 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylic acid (CAS 436867-71-9) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylic acid. InChIKey: ZCUAYUYDQUTSDE-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylic acid |
| InChIKey | ZCUAYUYDQUTSDE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCCNC1)C(=O)O |
Computed by PubChem (NCBI)