3-((tert-Butoxycarbonyl)(methoxy)amino)propanoic acid 95%
cas: 172299-81-9 — see every product listed under this CAS number, including other names
3-((tert-Butoxycarbonyl)(methoxy)amino)propanoic acid 95% (CAS 172299-81-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A204131-1g |
| cas | 172299-81-9 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 609.56 Pln | |
| Ambeed | 10g | 1010.06 Pln | |
| Ambeed | 250mg | 197.94 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A204131 |
3-[methoxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (CAS 172299-81-9) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: 3-[methoxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid. InChIKey: UIRKPSPBQPPPFX-UHFFFAOYSA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | 3-[methoxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| InChIKey | UIRKPSPBQPPPFX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCC(=O)O)OC |
Computed by PubChem (NCBI)
Synonyms:
N-(tert-Butoxycarbonyl)-N-methoxy-beta-alanine, 3-((tert-Butoxycarbonyl)(methoxy)amino)propanoic acid, N-Boc-N-methoxy-3-aminopropionic acid, 3-[methoxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid, 3-(tert-butoxycarbonyl(methoxy)amino)propanoic acid, 3-[tert-butoxycarbonyl(methoxy)amino]propanoic acid, 3-{[(tert-butoxy)carbonyl](methoxy)amino}propanoic acid