CAS 67198-87-2 appears in our catalog under these names: Boc-d-homoserine sodium salt, 95%, Sodium (R)-2-((tert-butoxycarbonyl)amino)-4-hydroxybutanoate, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 25g, 10g, 250mg.
(2R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 67198-87-2) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: (2R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: PZEMWPDUXBZKJN-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | (2R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | PZEMWPDUXBZKJN-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCO)C(=O)O |
Computed by PubChem (NCBI)