CAS 496918-28-6 appears in our catalog under these names: (R)-4-N-Boc-amino-2-hydroxybutyric acid, 95%, (R)-4-((tert-Butoxycarbonyl)amino)-2-hydroxybutanoic acid, 97%, (R)-4-N-Boc-amino-2-hydroxybutyric acid, (R)-4-N-Boc-amino-2-hydroxybutyric acid, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 0,1g, 0,25g, 0,5g, 2g, 500mg.
(2R)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 496918-28-6) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: (2R)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: POASMXSJVKADPM-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | (2R)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | POASMXSJVKADPM-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)NCC[C@H](C(=O)O)O |
Computed by PubChem (NCBI)